C20H19NO3S — CID 176531555
butyl 2-(naphthalen-2-ylamino)-4-(oxomethylidene)thiophene-3-carboxylate (PubChem CID 176531555) has the molecular formula C20H19NO3S and a molecular weight of 353.44 g/mol. Its IUPAC name is butyl 2-(naphthalen-2-ylamino)-4-(oxomethylidene)thiophene-3-carboxylate.
| Compound Name | butyl 2-(naphthalen-2-ylamino)-4-(oxomethylidene)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 176531555 |
| Molecular Formula | C20H19NO3S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | butyl 2-(naphthalen-2-ylamino)-4-(oxomethylidene)thiophene-3-carboxylate |
| SMILES | CCCCOC(=O)C1=C(Nc2ccc3ccccc3c2)SCC1=C=O |
| InChI | InChI=1S/C20H19NO3S/c1-2-3-10-24-20(23)18-16(12-22)13-25-19(18)21-17-9-8-14-6-4-5-7-15(14)11-17/h4-9,11,21H,2-3,10,13H2,1H3 |
| InChIKey | BIVMTAHIUVLXAB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|