C44H50F2N2O4 — CID 176531892
2-[[4-[4-[4-(1,1-difluorobut-3-enyl)phenoxy]benzoyl]cyclooctyl]methyl]-8-methyl-N-[2-(oxan-2-yl)ethyl]isoquinoline-7-carboxamide (PubChem CID 176531892) has the molecular formula C44H50F2N2O4 and a molecular weight of 708.89 g/mol. Its IUPAC name is 2-[[4-[4-[4-(1,1-difluorobut-3-enyl)phenoxy]benzoyl]cyclooctyl]methyl]-8-methyl-N-[2-(oxan-2-yl)ethyl]isoquinoline-7-carboxamide.
| Compound Name | 2-[[4-[4-[4-(1,1-difluorobut-3-enyl)phenoxy]benzoyl]cyclooctyl]methyl]-8-methyl-N-[2-(oxan-2-yl)ethyl]isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 176531892 |
| Molecular Formula | C44H50F2N2O4 |
| Molecular Weight | 708.89 g/mol |
| Exact Mass | 708.37 |
| IUPAC Name | 2-[[4-[4-[4-(1,1-difluorobut-3-enyl)phenoxy]benzoyl]cyclooctyl]methyl]-8-methyl-N-[2-(oxan-2-yl)ethyl]isoquinoline-7-carboxamide |
| SMILES | C=CCC(F)(F)c1ccc(Oc2ccc(C(=O)C3CCCCC(CN4C=C=c5ccc(C(=O)NCCC6CCCCO6)c(C)c5=C4)CC3)cc2)cc1 |
| InChI | InChI=1S/C44H50F2N2O4/c1-3-25-44(45,46)36-16-20-39(21-17-36)52-38-18-13-35(14-19-38)42(49)34-9-5-4-8-32(11-12-34)29-48-27-24-33-15-22-40(31(2)41(33)30-48)43(50)47-26-23-37-10-6-7-28-51-37/h3,13-22,27,30,32,34,37H,1,4-12,23,25-26,28-29H2,2H3,(H,47,50) |
| InChIKey | AZNCZNJUXOELRF-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.89 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|