C32H36F2N2O3 — CID 144747641
2-[[3-[4-(1,1-difluoroprop-2-enyl)benzoyl]cyclopentyl]methyl]-N-(2-ethoxyethyl)-6-methyl-3-methylideneisoquinoline-7-carboxamide (PubChem CID 144747641) has the molecular formula C32H36F2N2O3 and a molecular weight of 534.65 g/mol. Its IUPAC name is 2-[[3-[4-(1,1-difluoroprop-2-enyl)benzoyl]cyclopentyl]methyl]-N-(2-ethoxyethyl)-6-methyl-3-methylideneisoquinoline-7-carboxamide.
| Compound Name | 2-[[3-[4-(1,1-difluoroprop-2-enyl)benzoyl]cyclopentyl]methyl]-N-(2-ethoxyethyl)-6-methyl-3-methylideneisoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 144747641 |
| Molecular Formula | C32H36F2N2O3 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | 2-[[3-[4-(1,1-difluoroprop-2-enyl)benzoyl]cyclopentyl]methyl]-N-(2-ethoxyethyl)-6-methyl-3-methylideneisoquinoline-7-carboxamide |
| SMILES | C=CC(F)(F)c1ccc(C(=O)C2CCC(CN3C=c4cc(C(=O)NCCOCC)c(C)cc4=CC3=C)C2)cc1 |
| InChI | InChI=1S/C32H36F2N2O3/c1-5-32(33,34)28-11-9-24(10-12-28)30(37)25-8-7-23(17-25)19-36-20-27-18-29(31(38)35-13-14-39-6-2)21(3)15-26(27)16-22(36)4/h5,9-12,15-16,18,20,23,25H,1,4,6-8,13-14,17,19H2,2-3H3,(H,35,38) |
| InChIKey | XUHJQUKWKPXTDY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|