C30H35F2N3O4 — CID 123748350
2-[2-(aminomethyl)-5-[4-(1,1-difluoroprop-2-enoxy)phenyl]-5-oxopentyl]-N-(2-methoxyethyl)-6-methyl-3-methylideneisoquinoline-7-carboxamide (PubChem CID 123748350) has the molecular formula C30H35F2N3O4 and a molecular weight of 539.62 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-5-[4-(1,1-difluoroprop-2-enoxy)phenyl]-5-oxopentyl]-N-(2-methoxyethyl)-6-methyl-3-methylideneisoquinoline-7-carboxamide.
| Compound Name | 2-[2-(aminomethyl)-5-[4-(1,1-difluoroprop-2-enoxy)phenyl]-5-oxopentyl]-N-(2-methoxyethyl)-6-methyl-3-methylideneisoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 123748350 |
| Molecular Formula | C30H35F2N3O4 |
| Molecular Weight | 539.62 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | 2-[2-(aminomethyl)-5-[4-(1,1-difluoroprop-2-enoxy)phenyl]-5-oxopentyl]-N-(2-methoxyethyl)-6-methyl-3-methylideneisoquinoline-7-carboxamide |
| SMILES | C=CC(F)(F)Oc1ccc(C(=O)CCC(CN)CN2C=c3cc(C(=O)NCCOC)c(C)cc3=CC2=C)cc1 |
| InChI | InChI=1S/C30H35F2N3O4/c1-5-30(31,32)39-26-9-7-23(8-10-26)28(36)11-6-22(17-33)18-35-19-25-16-27(29(37)34-12-13-38-4)20(2)14-24(25)15-21(35)3/h5,7-10,14-16,19,22H,1,3,6,11-13,17-18,33H2,2,4H3,(H,34,37) |
| InChIKey | JMQFAFFQSPOPOM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.62 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|