C33H41ClF2N2O3 — CID 123619479
2-[(E)-6-(4-chlorophenyl)-2-ethyl-4-methyl-6-oxohex-3-enyl]-N-[2-(1,1-difluoropropoxy)ethyl]-3,7-dimethyl-3,4-dihydro-2-benzazepine-8-carboxamide (PubChem CID 123619479) has the molecular formula C33H41ClF2N2O3 and a molecular weight of 587.15 g/mol. Its IUPAC name is 2-[(E)-6-(4-chlorophenyl)-2-ethyl-4-methyl-6-oxohex-3-enyl]-N-[2-(1,1-difluoropropoxy)ethyl]-3,7-dimethyl-3,4-dihydro-2-benzazepine-8-carboxamide.
| Compound Name | 2-[(E)-6-(4-chlorophenyl)-2-ethyl-4-methyl-6-oxohex-3-enyl]-N-[2-(1,1-difluoropropoxy)ethyl]-3,7-dimethyl-3,4-dihydro-2-benzazepine-8-carboxamide |
|---|---|
| PubChem CID | 123619479 |
| Molecular Formula | C33H41ClF2N2O3 |
| Molecular Weight | 587.15 g/mol |
| Exact Mass | 586.28 |
| IUPAC Name | 2-[(E)-6-(4-chlorophenyl)-2-ethyl-4-methyl-6-oxohex-3-enyl]-N-[2-(1,1-difluoropropoxy)ethyl]-3,7-dimethyl-3,4-dihydro-2-benzazepine-8-carboxamide |
| SMILES | CCC(/C=C(\C)CC(=O)c1ccc(Cl)cc1)CN1C=c2cc(C(=O)NCCOC(F)(F)CC)c(C)cc2=CCC1C |
| InChI | InChI=1S/C33H41ClF2N2O3/c1-6-25(16-22(3)17-31(39)26-10-12-29(34)13-11-26)20-38-21-28-19-30(23(4)18-27(28)9-8-24(38)5)32(40)37-14-15-41-33(35,36)7-2/h9-13,16,18-19,21,24-25H,6-8,14-15,17,20H2,1-5H3,(H,37,40)/b22-16+ |
| InChIKey | HTNJAKJEZVEYSQ-CJLVFECKSA-N |
| XLogP | 6.26 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.15 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|