C32H38ClF3N2O3 — CID 123774959
2-[(E)-6-(4-chlorophenyl)-2-ethyl-4-methyl-6-oxohex-3-enyl]-3,9-dimethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-3,4-dihydro-2-benzazepine-8-carboxamide (PubChem CID 123774959) has the molecular formula C32H38ClF3N2O3 and a molecular weight of 591.11 g/mol. Its IUPAC name is 2-[(E)-6-(4-chlorophenyl)-2-ethyl-4-methyl-6-oxohex-3-enyl]-3,9-dimethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-3,4-dihydro-2-benzazepine-8-carboxamide.
| Compound Name | 2-[(E)-6-(4-chlorophenyl)-2-ethyl-4-methyl-6-oxohex-3-enyl]-3,9-dimethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-3,4-dihydro-2-benzazepine-8-carboxamide |
|---|---|
| PubChem CID | 123774959 |
| Molecular Formula | C32H38ClF3N2O3 |
| Molecular Weight | 591.11 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | 2-[(E)-6-(4-chlorophenyl)-2-ethyl-4-methyl-6-oxohex-3-enyl]-3,9-dimethyl-N-[2-(2,2,2-trifluoroethoxy)ethyl]-3,4-dihydro-2-benzazepine-8-carboxamide |
| SMILES | CCC(/C=C(\C)CC(=O)c1ccc(Cl)cc1)CN1C=c2c(C)c(C(=O)NCCOCC(F)(F)F)ccc2=CCC1C |
| InChI | InChI=1S/C32H38ClF3N2O3/c1-5-24(16-21(2)17-30(39)26-8-11-27(33)12-9-26)18-38-19-29-23(4)28(13-10-25(29)7-6-22(38)3)31(40)37-14-15-41-20-32(34,35)36/h7-13,16,19,22,24H,5-6,14-15,17-18,20H2,1-4H3,(H,37,40)/b21-16+ |
| InChIKey | RIOCKLIPXBCUFH-LTGZKZEYSA-N |
| XLogP | 5.82 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.11 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|