C25H39N3O2 — CID 123660733
2-(2-ethyl-4-iminopentyl)-N-(2-methoxybutyl)-3,7-dimethyl-3,4-dihydro-2-benzazepine-8-carboxamide (PubChem CID 123660733) has the molecular formula C25H39N3O2 and a molecular weight of 413.61 g/mol. Its IUPAC name is 2-(2-ethyl-4-iminopentyl)-N-(2-methoxybutyl)-3,7-dimethyl-3,4-dihydro-2-benzazepine-8-carboxamide.
| Compound Name | 2-(2-ethyl-4-iminopentyl)-N-(2-methoxybutyl)-3,7-dimethyl-3,4-dihydro-2-benzazepine-8-carboxamide |
|---|---|
| PubChem CID | 123660733 |
| Molecular Formula | C25H39N3O2 |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.30 |
| IUPAC Name | 2-(2-ethyl-4-iminopentyl)-N-(2-methoxybutyl)-3,7-dimethyl-3,4-dihydro-2-benzazepine-8-carboxamide |
| SMILES | [H]/N=C(\C)CC(CC)CN1C=c2cc(C(=O)NCC(CC)OC)c(C)cc2=CCC1C |
| InChI | InChI=1S/C25H39N3O2/c1-7-20(12-18(4)26)15-28-16-22-13-24(25(29)27-14-23(8-2)30-6)17(3)11-21(22)10-9-19(28)5/h10-11,13,16,19-20,23,26H,7-9,12,14-15H2,1-6H3,(H,27,29)/b26-18+ |
| InChIKey | RBGFCDZGUQPKIM-NLRVBDNBSA-N |
| XLogP | 3.22 |
| TPSA | 65.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|