C26H19N3O — CID 176533522
10-benzyl-6-phenyl-2,10,13-triazatricyclo[9.5.0.03,8]hexadeca-1(16),3(8),4,6,11,13,14-heptaen-9-one (PubChem CID 176533522) has the molecular formula C26H19N3O and a molecular weight of 389.46 g/mol. Its IUPAC name is 10-benzyl-6-phenyl-2,10,13-triazatricyclo[9.5.0.03,8]hexadeca-1(16),3(8),4,6,11,13,14-heptaen-9-one.
| Compound Name | 10-benzyl-6-phenyl-2,10,13-triazatricyclo[9.5.0.03,8]hexadeca-1(16),3(8),4,6,11,13,14-heptaen-9-one |
|---|---|
| PubChem CID | 176533522 |
| Molecular Formula | C26H19N3O |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 10-benzyl-6-phenyl-2,10,13-triazatricyclo[9.5.0.03,8]hexadeca-1(16),3(8),4,6,11,13,14-heptaen-9-one |
| SMILES | O=C1c2cc(-c3ccccc3)ccc2NC2=CC=C=NC=C2N1Cc1ccccc1 |
| InChI | InChI=1S/C26H19N3O/c30-26-22-16-21(20-10-5-2-6-11-20)13-14-23(22)28-24-12-7-15-27-17-25(24)29(26)18-19-8-3-1-4-9-19/h1-14,16-17,28H,18H2 |
| InChIKey | LIVJDYJAUYQNNU-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |