C10H11N — CID 176533877
3-methyl-N-propa-1,2-dienylaniline (PubChem CID 176533877) has the molecular formula C10H11N and a molecular weight of 145.20 g/mol. Its IUPAC name is 3-methyl-N-propa-1,2-dienylaniline.
| Compound Name | 3-methyl-N-propa-1,2-dienylaniline |
|---|---|
| PubChem CID | 176533877 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 3-methyl-N-propa-1,2-dienylaniline |
| SMILES | C=C=CNc1cccc(C)c1 |
| InChI | InChI=1S/C10H11N/c1-3-7-11-10-6-4-5-9(2)8-10/h4-8,11H,1H2,2H3 |
| InChIKey | PALLHJQLJMVIHX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |