C11H19NO — CID 176534164
3-methyl-4-(2-methylpropylamino)hexa-4,5-dien-2-one (PubChem CID 176534164) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 3-methyl-4-(2-methylpropylamino)hexa-4,5-dien-2-one.
| Compound Name | 3-methyl-4-(2-methylpropylamino)hexa-4,5-dien-2-one |
|---|---|
| PubChem CID | 176534164 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 3-methyl-4-(2-methylpropylamino)hexa-4,5-dien-2-one |
| SMILES | C=C=C(NCC(C)C)C(C)C(C)=O |
| InChI | InChI=1S/C11H19NO/c1-6-11(9(4)10(5)13)12-7-8(2)3/h8-9,12H,1,7H2,2-5H3 |
| InChIKey | BUEVELPPKCVSTP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |