C18H16N2O5 — CID 176536412
tert-butyl N-[2-oxo-5-(oxomethylidene)-1H-chromeno[2,3-b]pyridin-7-yl]carbamate (PubChem CID 176536412) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is tert-butyl N-[2-oxo-5-(oxomethylidene)-1H-chromeno[2,3-b]pyridin-7-yl]carbamate.
| Compound Name | tert-butyl N-[2-oxo-5-(oxomethylidene)-1H-chromeno[2,3-b]pyridin-7-yl]carbamate |
|---|---|
| PubChem CID | 176536412 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | tert-butyl N-[2-oxo-5-(oxomethylidene)-1H-chromeno[2,3-b]pyridin-7-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc2c(c1)C(=C=O)c1ccc(=O)[nH]c1O2 |
| InChI | InChI=1S/C18H16N2O5/c1-18(2,3)25-17(23)19-10-4-6-14-12(8-10)13(9-21)11-5-7-15(22)20-16(11)24-14/h4-8H,1-3H3,(H,19,23)(H,20,22) |
| InChIKey | KCPFCQHCUKZSRA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|