C30H28N4+2 — CID 176537324
1-[3-[2,7-dimethyl-9-(1H-pyrazol-5-yl)fluoren-9-yl]phenyl]-3,4,5-trimethylimidazole-1,3-diium (PubChem CID 176537324) has the molecular formula C30H28N4+2 and a molecular weight of 444.58 g/mol. Its IUPAC name is 1-[3-[2,7-dimethyl-9-(1H-pyrazol-5-yl)fluoren-9-yl]phenyl]-3,4,5-trimethylimidazole-1,3-diium.
| Compound Name | 1-[3-[2,7-dimethyl-9-(1H-pyrazol-5-yl)fluoren-9-yl]phenyl]-3,4,5-trimethylimidazole-1,3-diium |
|---|---|
| PubChem CID | 176537324 |
| Molecular Formula | C30H28N4+2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 1-[3-[2,7-dimethyl-9-(1H-pyrazol-5-yl)fluoren-9-yl]phenyl]-3,4,5-trimethylimidazole-1,3-diium |
| SMILES | CC1=C(C)[N+](c2cccc(C3(c4ccn[nH]4)c4cc(C)ccc4-c4ccc(C)cc43)c2)=C=[N+]1C |
| InChI | InChI=1S/C30H28N4/c1-19-9-11-25-26-12-10-20(2)16-28(26)30(27(25)15-19,29-13-14-31-32-29)23-7-6-8-24(17-23)34-18-33(5)21(3)22(34)4/h6-17H,1-5H3,(H,31,32)/q+2 |
| InChIKey | VKVVDIJHBJHCOG-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 34.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|