C37H26N6+2 — CID 176537336
9-(3-methylimidazole-1,3-diium-1-yl)-9-[3-[9-(1H-pyrazol-5-yl)indeno[2,1-c]pyridin-9-yl]phenyl]indeno[2,1-c]pyridine (PubChem CID 176537336) has the molecular formula C37H26N6+2 and a molecular weight of 554.66 g/mol. Its IUPAC name is 9-(3-methylimidazole-1,3-diium-1-yl)-9-[3-[9-(1H-pyrazol-5-yl)indeno[2,1-c]pyridin-9-yl]phenyl]indeno[2,1-c]pyridine.
| Compound Name | 9-(3-methylimidazole-1,3-diium-1-yl)-9-[3-[9-(1H-pyrazol-5-yl)indeno[2,1-c]pyridin-9-yl]phenyl]indeno[2,1-c]pyridine |
|---|---|
| PubChem CID | 176537336 |
| Molecular Formula | C37H26N6+2 |
| Molecular Weight | 554.66 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | 9-(3-methylimidazole-1,3-diium-1-yl)-9-[3-[9-(1H-pyrazol-5-yl)indeno[2,1-c]pyridin-9-yl]phenyl]indeno[2,1-c]pyridine |
| SMILES | C[N+]1=C=[N+](C2(c3cccc(C4(c5ccn[nH]5)c5ccccc5-c5ccncc54)c3)c3ccccc3-c3ccncc32)C=C1 |
| InChI | InChI=1S/C37H26N6/c1-42-19-20-43(24-42)37(32-12-5-3-10-28(32)30-14-17-39-23-34(30)37)26-8-6-7-25(21-26)36(35-15-18-40-41-35)31-11-4-2-9-27(31)29-13-16-38-22-33(29)36/h2-23H,1H3,(H,40,41)/q+2 |
| InChIKey | HXKBALLRXAPNEO-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 60.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.66 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|