C27H23N5+2 — CID 176537331
9-(1H-pyrazol-5-yl)-9-[3-(3,4,5-trimethylimidazole-1,3-diium-1-yl)phenyl]indeno[2,1-c]pyridine (PubChem CID 176537331) has the molecular formula C27H23N5+2 and a molecular weight of 417.52 g/mol. Its IUPAC name is 9-(1H-pyrazol-5-yl)-9-[3-(3,4,5-trimethylimidazole-1,3-diium-1-yl)phenyl]indeno[2,1-c]pyridine.
| Compound Name | 9-(1H-pyrazol-5-yl)-9-[3-(3,4,5-trimethylimidazole-1,3-diium-1-yl)phenyl]indeno[2,1-c]pyridine |
|---|---|
| PubChem CID | 176537331 |
| Molecular Formula | C27H23N5+2 |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 9-(1H-pyrazol-5-yl)-9-[3-(3,4,5-trimethylimidazole-1,3-diium-1-yl)phenyl]indeno[2,1-c]pyridine |
| SMILES | CC1=C(C)[N+](c2cccc(C3(c4ccn[nH]4)c4ccccc4-c4ccncc43)c2)=C=[N+]1C |
| InChI | InChI=1S/C27H23N5/c1-18-19(2)32(17-31(18)3)21-8-6-7-20(15-21)27(26-12-14-29-30-26)24-10-5-4-9-22(24)23-11-13-28-16-25(23)27/h4-16H,1-3H3,(H,29,30)/q+2 |
| InChIKey | ZCTYHIJKOUNVAD-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 47.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|