C28H20N6+2 — CID 176537332
8-[3-(3-methylbenzimidazole-1,3-diium-1-yl)phenyl]-8-(1H-pyrazol-5-yl)-6,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 176537332) has the molecular formula C28H20N6+2 and a molecular weight of 440.51 g/mol. Its IUPAC name is 8-[3-(3-methylbenzimidazole-1,3-diium-1-yl)phenyl]-8-(1H-pyrazol-5-yl)-6,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 8-[3-(3-methylbenzimidazole-1,3-diium-1-yl)phenyl]-8-(1H-pyrazol-5-yl)-6,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 176537332 |
| Molecular Formula | C28H20N6+2 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 8-[3-(3-methylbenzimidazole-1,3-diium-1-yl)phenyl]-8-(1H-pyrazol-5-yl)-6,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | C[N+]1=C=[N+](c2cccc(C3(c4ccn[nH]4)c4ncccc4-c4cccnc43)c2)c2ccccc21 |
| InChI | InChI=1S/C28H20N6/c1-33-18-34(24-12-3-2-11-23(24)33)20-8-4-7-19(17-20)28(25-13-16-31-32-25)26-21(9-5-14-29-26)22-10-6-15-30-27(22)28/h2-17H,1H3,(H,31,32)/q+2 |
| InChIKey | QVQHMQICFFLPDC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 60.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|