C38H25N4+ — CID 176537326
1-[9-[3-[9-(1H-pyrazol-5-yl)fluoren-9-yl]phenyl]fluoren-9-yl]imidazol-1-ium (PubChem CID 176537326) has the molecular formula C38H25N4+ and a molecular weight of 537.65 g/mol. Its IUPAC name is 1-[9-[3-[9-(1H-pyrazol-5-yl)fluoren-9-yl]phenyl]fluoren-9-yl]imidazol-1-ium.
| Compound Name | 1-[9-[3-[9-(1H-pyrazol-5-yl)fluoren-9-yl]phenyl]fluoren-9-yl]imidazol-1-ium |
|---|---|
| PubChem CID | 176537326 |
| Molecular Formula | C38H25N4+ |
| Molecular Weight | 537.65 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | 1-[9-[3-[9-(1H-pyrazol-5-yl)fluoren-9-yl]phenyl]fluoren-9-yl]imidazol-1-ium |
| SMILES | C1=NC=C[N+]=1C1(c2cccc(C3(c4ccn[nH]4)c4ccccc4-c4ccccc43)c2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C38H25N4/c1-5-16-32-28(12-1)29-13-2-6-17-33(29)37(32,36-20-21-40-41-36)26-10-9-11-27(24-26)38(42-23-22-39-25-42)34-18-7-3-14-30(34)31-15-4-8-19-35(31)38/h1-24H,(H,40,41)/q+1 |
| InChIKey | BPWVDDAIAZLLBU-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 44.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.65 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|