C18H12N4O2 — CID 176537603
carbon dioxide;4-[4-[2-(2H-triazol-4-yl)ethenyl]phenyl]benzonitrile (PubChem CID 176537603) has the molecular formula C18H12N4O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is carbon dioxide;4-[4-[2-(2H-triazol-4-yl)ethenyl]phenyl]benzonitrile.
| Compound Name | carbon dioxide;4-[4-[2-(2H-triazol-4-yl)ethenyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 176537603 |
| Molecular Formula | C18H12N4O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | carbon dioxide;4-[4-[2-(2H-triazol-4-yl)ethenyl]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(C=Cc3cn[nH]n3)cc2)cc1.O=C=O |
| InChI | InChI=1S/C17H12N4.CO2/c18-11-14-3-8-16(9-4-14)15-6-1-13(2-7-15)5-10-17-12-19-21-20-17;2-1-3/h1-10,12H,(H,19,20,21); |
| InChIKey | ZWXRNMTVBCKUKV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |