C19H38N10 — CID 176539765
4-N-[4-[[6-(dimethylamino)-4-methyl-1,4-dihydro-1,3,5-triazin-2-yl]-methylamino]butyl]-6-N-ethyl-4-N,6-N,2-trimethyl-1,2-dihydro-1,3,5-triazine-4,6-diamine (PubChem CID 176539765) has the molecular formula C19H38N10 and a molecular weight of 406.58 g/mol. Its IUPAC name is 4-N-[4-[[6-(dimethylamino)-4-methyl-1,4-dihydro-1,3,5-triazin-2-yl]-methylamino]butyl]-6-N-ethyl-4-N,6-N,2-trimethyl-1,2-dihydro-1,3,5-triazine-4,6-diamine.
| Compound Name | 4-N-[4-[[6-(dimethylamino)-4-methyl-1,4-dihydro-1,3,5-triazin-2-yl]-methylamino]butyl]-6-N-ethyl-4-N,6-N,2-trimethyl-1,2-dihydro-1,3,5-triazine-4,6-diamine |
|---|---|
| PubChem CID | 176539765 |
| Molecular Formula | C19H38N10 |
| Molecular Weight | 406.58 g/mol |
| Exact Mass | 406.33 |
| IUPAC Name | 4-N-[4-[[6-(dimethylamino)-4-methyl-1,4-dihydro-1,3,5-triazin-2-yl]-methylamino]butyl]-6-N-ethyl-4-N,6-N,2-trimethyl-1,2-dihydro-1,3,5-triazine-4,6-diamine |
| SMILES | CCN(C)C1=NC(N(C)CCCCN(C)C2=NC(C)N=C(N(C)C)N2)=NC(C)N1 |
| InChI | InChI=1S/C19H38N10/c1-9-27(6)17-21-15(3)23-19(25-17)29(8)13-11-10-12-28(7)18-22-14(2)20-16(24-18)26(4)5/h14-15H,9-13H2,1-8H3,(H,20,22,24)(H,21,23,25) |
| InChIKey | CLTNHZNQJDOQLX-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.58 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|