C14H28N10 — CID 137123598
6-N-[2-(4-amino-6-butylimino-2,5-dihydro-1H-1,3,5-triazin-2-yl)ethyl]-6-N,4-dimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine (PubChem CID 137123598) has the molecular formula C14H28N10 and a molecular weight of 336.45 g/mol. Its IUPAC name is 6-N-[2-(4-amino-6-butylimino-2,5-dihydro-1H-1,3,5-triazin-2-yl)ethyl]-6-N,4-dimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine.
| Compound Name | 6-N-[2-(4-amino-6-butylimino-2,5-dihydro-1H-1,3,5-triazin-2-yl)ethyl]-6-N,4-dimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine |
|---|---|
| PubChem CID | 137123598 |
| Molecular Formula | C14H28N10 |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 6-N-[2-(4-amino-6-butylimino-2,5-dihydro-1H-1,3,5-triazin-2-yl)ethyl]-6-N,4-dimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine |
| SMILES | CCCC/N=C1/NC(N)=NC(CCN(C)C2=NC(C)N=C(N)N2)N1 |
| InChI | InChI=1S/C14H28N10/c1-4-5-7-17-13-21-10(20-12(16)22-13)6-8-24(3)14-19-9(2)18-11(15)23-14/h9-10H,4-8H2,1-3H3,(H3,15,18,19,23)(H4,16,17,20,21,22) |
| InChIKey | NVOPSKURWBNNKW-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 140.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|