C12H25N5 — CID 136590877
N,N,2,5-tetramethyl-6-pentylimino-1,2-dihydro-1,3,5-triazin-4-amine (PubChem CID 136590877) has the molecular formula C12H25N5 and a molecular weight of 239.37 g/mol. Its IUPAC name is N,N,2,5-tetramethyl-6-pentylimino-1,2-dihydro-1,3,5-triazin-4-amine.
| Compound Name | N,N,2,5-tetramethyl-6-pentylimino-1,2-dihydro-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 136590877 |
| Molecular Formula | C12H25N5 |
| Molecular Weight | 239.37 g/mol |
| Exact Mass | 239.21 |
| IUPAC Name | N,N,2,5-tetramethyl-6-pentylimino-1,2-dihydro-1,3,5-triazin-4-amine |
| SMILES | CCCCC/N=C1\NC(C)N=C(N(C)C)N1C |
| InChI | InChI=1S/C12H25N5/c1-6-7-8-9-13-11-14-10(2)15-12(16(3)4)17(11)5/h10H,6-9H2,1-5H3,(H,13,14) |
| InChIKey | LTGVIPYBWHFLRR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 43.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|