C9H19N5 — CID 176533741
6-imino-N,2,5-trimethyl-N-propyl-1,2-dihydro-1,3,5-triazin-4-amine (PubChem CID 176533741) has the molecular formula C9H19N5 and a molecular weight of 197.29 g/mol. Its IUPAC name is 6-imino-N,2,5-trimethyl-N-propyl-1,2-dihydro-1,3,5-triazin-4-amine.
| Compound Name | 6-imino-N,2,5-trimethyl-N-propyl-1,2-dihydro-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 176533741 |
| Molecular Formula | C9H19N5 |
| Molecular Weight | 197.29 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | 6-imino-N,2,5-trimethyl-N-propyl-1,2-dihydro-1,3,5-triazin-4-amine |
| SMILES | [H]/N=C1\NC(C)N=C(N(C)CCC)N1C |
| InChI | InChI=1S/C9H19N5/c1-5-6-13(3)9-12-7(2)11-8(10)14(9)4/h7H,5-6H2,1-4H3,(H2,10,11) |
| InChIKey | BQGHXNYFGIKVRT-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 54.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.29 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|