C18H34N6O2 — CID 167998696
8-[2-(dimethylamino)ethylimino]-3-methyl-7-octyl-5,9-dihydro-4H-purine-2,6-dione (PubChem CID 167998696) has the molecular formula C18H34N6O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 8-[2-(dimethylamino)ethylimino]-3-methyl-7-octyl-5,9-dihydro-4H-purine-2,6-dione.
| Compound Name | 8-[2-(dimethylamino)ethylimino]-3-methyl-7-octyl-5,9-dihydro-4H-purine-2,6-dione |
|---|---|
| PubChem CID | 167998696 |
| Molecular Formula | C18H34N6O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.27 |
| IUPAC Name | 8-[2-(dimethylamino)ethylimino]-3-methyl-7-octyl-5,9-dihydro-4H-purine-2,6-dione |
| SMILES | CCCCCCCCN1/C(=N/CCN(C)C)NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C18H34N6O2/c1-5-6-7-8-9-10-12-24-14-15(23(4)18(26)21-16(14)25)20-17(24)19-11-13-22(2)3/h14-15H,5-13H2,1-4H3,(H,19,20)(H,21,25,26) |
| InChIKey | ZSUNNRBRIMXYOE-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|