C16H27N5O2 — CID 137263539
7-heptyl-3-methyl-8-prop-2-enylimino-5,9-dihydro-4H-purine-2,6-dione (PubChem CID 137263539) has the molecular formula C16H27N5O2 and a molecular weight of 321.43 g/mol. Its IUPAC name is 7-heptyl-3-methyl-8-prop-2-enylimino-5,9-dihydro-4H-purine-2,6-dione.
| Compound Name | 7-heptyl-3-methyl-8-prop-2-enylimino-5,9-dihydro-4H-purine-2,6-dione |
|---|---|
| PubChem CID | 137263539 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 7-heptyl-3-methyl-8-prop-2-enylimino-5,9-dihydro-4H-purine-2,6-dione |
| SMILES | C=CC/N=C1\NC2C(C(=O)NC(=O)N2C)N1CCCCCCC |
| InChI | InChI=1S/C16H27N5O2/c1-4-6-7-8-9-11-21-12-13(18-15(21)17-10-5-2)20(3)16(23)19-14(12)22/h5,12-13H,2,4,6-11H2,1,3H3,(H,17,18)(H,19,22,23) |
| InChIKey | YFFFEUMEBQMUFQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|