C10H17N5O3 — CID 137274686
7-(2-methoxyethyl)-3-methyl-8-methylimino-5,9-dihydro-4H-purine-2,6-dione (PubChem CID 137274686) has the molecular formula C10H17N5O3 and a molecular weight of 255.28 g/mol. Its IUPAC name is 7-(2-methoxyethyl)-3-methyl-8-methylimino-5,9-dihydro-4H-purine-2,6-dione.
| Compound Name | 7-(2-methoxyethyl)-3-methyl-8-methylimino-5,9-dihydro-4H-purine-2,6-dione |
|---|---|
| PubChem CID | 137274686 |
| Molecular Formula | C10H17N5O3 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 7-(2-methoxyethyl)-3-methyl-8-methylimino-5,9-dihydro-4H-purine-2,6-dione |
| SMILES | C/N=C1\NC2C(C(=O)NC(=O)N2C)N1CCOC |
| InChI | InChI=1S/C10H17N5O3/c1-11-9-12-7-6(15(9)4-5-18-3)8(16)13-10(17)14(7)2/h6-7H,4-5H2,1-3H3,(H,11,12)(H,13,16,17) |
| InChIKey | BBEFCOORBHVQKS-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|