C21H31N5O5 — CID 167998741
7-[3-(3-ethylphenoxy)-2-hydroxypropyl]-8-(3-methoxypropylimino)-3-methyl-5,9-dihydro-4H-purine-2,6-dione (PubChem CID 167998741) has the molecular formula C21H31N5O5 and a molecular weight of 433.51 g/mol. Its IUPAC name is 7-[3-(3-ethylphenoxy)-2-hydroxypropyl]-8-(3-methoxypropylimino)-3-methyl-5,9-dihydro-4H-purine-2,6-dione.
| Compound Name | 7-[3-(3-ethylphenoxy)-2-hydroxypropyl]-8-(3-methoxypropylimino)-3-methyl-5,9-dihydro-4H-purine-2,6-dione |
|---|---|
| PubChem CID | 167998741 |
| Molecular Formula | C21H31N5O5 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 7-[3-(3-ethylphenoxy)-2-hydroxypropyl]-8-(3-methoxypropylimino)-3-methyl-5,9-dihydro-4H-purine-2,6-dione |
| SMILES | CCc1cccc(OCC(O)CN2/C(=N/CCCOC)NC3C2C(=O)NC(=O)N3C)c1 |
| InChI | InChI=1S/C21H31N5O5/c1-4-14-7-5-8-16(11-14)31-13-15(27)12-26-17-18(25(2)21(29)24-19(17)28)23-20(26)22-9-6-10-30-3/h5,7-8,11,15,17-18,27H,4,6,9-10,12-13H2,1-3H3,(H,22,23)(H,24,28,29) |
| InChIKey | KTEKAZPGOUUNMF-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|