C23H31N7O4 — CID 137257943
7-[2-hydroxy-3-(2-methylphenoxy)propyl]-8-(3-imidazol-1-ylpropylimino)-1,3-dimethyl-5,9-dihydro-4H-purine-2,6-dione (PubChem CID 137257943) has the molecular formula C23H31N7O4 and a molecular weight of 469.55 g/mol. Its IUPAC name is 7-[2-hydroxy-3-(2-methylphenoxy)propyl]-8-(3-imidazol-1-ylpropylimino)-1,3-dimethyl-5,9-dihydro-4H-purine-2,6-dione.
| Compound Name | 7-[2-hydroxy-3-(2-methylphenoxy)propyl]-8-(3-imidazol-1-ylpropylimino)-1,3-dimethyl-5,9-dihydro-4H-purine-2,6-dione |
|---|---|
| PubChem CID | 137257943 |
| Molecular Formula | C23H31N7O4 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 7-[2-hydroxy-3-(2-methylphenoxy)propyl]-8-(3-imidazol-1-ylpropylimino)-1,3-dimethyl-5,9-dihydro-4H-purine-2,6-dione |
| SMILES | Cc1ccccc1OCC(O)CN1/C(=N/CCCn2ccnc2)NC2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C23H31N7O4/c1-16-7-4-5-8-18(16)34-14-17(31)13-30-19-20(27(2)23(33)28(3)21(19)32)26-22(30)25-9-6-11-29-12-10-24-15-29/h4-5,7-8,10,12,15,17,19-20,31H,6,9,11,13-14H2,1-3H3,(H,25,26) |
| InChIKey | MKGKMECPLJIEBE-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|