C21H31N5O4 — CID 167998171
7-[2-hydroxy-3-(3-methylphenoxy)propyl]-3-methyl-8-pentylimino-5,9-dihydro-4H-purine-2,6-dione (PubChem CID 167998171) has the molecular formula C21H31N5O4 and a molecular weight of 417.51 g/mol. Its IUPAC name is 7-[2-hydroxy-3-(3-methylphenoxy)propyl]-3-methyl-8-pentylimino-5,9-dihydro-4H-purine-2,6-dione.
| Compound Name | 7-[2-hydroxy-3-(3-methylphenoxy)propyl]-3-methyl-8-pentylimino-5,9-dihydro-4H-purine-2,6-dione |
|---|---|
| PubChem CID | 167998171 |
| Molecular Formula | C21H31N5O4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 7-[2-hydroxy-3-(3-methylphenoxy)propyl]-3-methyl-8-pentylimino-5,9-dihydro-4H-purine-2,6-dione |
| SMILES | CCCCC/N=C1\NC2C(C(=O)NC(=O)N2C)N1CC(O)COc1cccc(C)c1 |
| InChI | InChI=1S/C21H31N5O4/c1-4-5-6-10-22-20-23-18-17(19(28)24-21(29)25(18)3)26(20)12-15(27)13-30-16-9-7-8-14(2)11-16/h7-9,11,15,17-18,27H,4-6,10,12-13H2,1-3H3,(H,22,23)(H,24,28,29) |
| InChIKey | CYMDUODCDCGFFO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|