C23H34N6O5 — CID 167997741
7-[3-(3-ethylphenoxy)-2-hydroxypropyl]-3-methyl-8-(2-morpholin-4-ylethylimino)-5,9-dihydro-4H-purine-2,6-dione (PubChem CID 167997741) has the molecular formula C23H34N6O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is 7-[3-(3-ethylphenoxy)-2-hydroxypropyl]-3-methyl-8-(2-morpholin-4-ylethylimino)-5,9-dihydro-4H-purine-2,6-dione.
| Compound Name | 7-[3-(3-ethylphenoxy)-2-hydroxypropyl]-3-methyl-8-(2-morpholin-4-ylethylimino)-5,9-dihydro-4H-purine-2,6-dione |
|---|---|
| PubChem CID | 167997741 |
| Molecular Formula | C23H34N6O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 7-[3-(3-ethylphenoxy)-2-hydroxypropyl]-3-methyl-8-(2-morpholin-4-ylethylimino)-5,9-dihydro-4H-purine-2,6-dione |
| SMILES | CCc1cccc(OCC(O)CN2/C(=N/CCN3CCOCC3)NC3C2C(=O)NC(=O)N3C)c1 |
| InChI | InChI=1S/C23H34N6O5/c1-3-16-5-4-6-18(13-16)34-15-17(30)14-29-19-20(27(2)23(32)26-21(19)31)25-22(29)24-7-8-28-9-11-33-12-10-28/h4-6,13,17,19-20,30H,3,7-12,14-15H2,1-2H3,(H,24,25)(H,26,31,32) |
| InChIKey | XBIYZAQHLCFQCB-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|