C17H31N5O3 — CID 167999814
8-(2-ethylhexylimino)-7-(2-hydroxypropyl)-3-methyl-5,9-dihydro-4H-purine-2,6-dione (PubChem CID 167999814) has the molecular formula C17H31N5O3 and a molecular weight of 353.47 g/mol. Its IUPAC name is 8-(2-ethylhexylimino)-7-(2-hydroxypropyl)-3-methyl-5,9-dihydro-4H-purine-2,6-dione.
| Compound Name | 8-(2-ethylhexylimino)-7-(2-hydroxypropyl)-3-methyl-5,9-dihydro-4H-purine-2,6-dione |
|---|---|
| PubChem CID | 167999814 |
| Molecular Formula | C17H31N5O3 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | 8-(2-ethylhexylimino)-7-(2-hydroxypropyl)-3-methyl-5,9-dihydro-4H-purine-2,6-dione |
| SMILES | CCCCC(CC)C/N=C1\NC2C(C(=O)NC(=O)N2C)N1CC(C)O |
| InChI | InChI=1S/C17H31N5O3/c1-5-7-8-12(6-2)9-18-16-19-14-13(22(16)10-11(3)23)15(24)20-17(25)21(14)4/h11-14,23H,5-10H2,1-4H3,(H,18,19)(H,20,24,25) |
| InChIKey | MTLUUGXTJRMEFE-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|