C14H25N5O4 — CID 167999634
7-(2-ethoxyethyl)-8-(3-methoxypropylimino)-3-methyl-5,9-dihydro-4H-purine-2,6-dione (PubChem CID 167999634) has the molecular formula C14H25N5O4 and a molecular weight of 327.39 g/mol. Its IUPAC name is 7-(2-ethoxyethyl)-8-(3-methoxypropylimino)-3-methyl-5,9-dihydro-4H-purine-2,6-dione.
| Compound Name | 7-(2-ethoxyethyl)-8-(3-methoxypropylimino)-3-methyl-5,9-dihydro-4H-purine-2,6-dione |
|---|---|
| PubChem CID | 167999634 |
| Molecular Formula | C14H25N5O4 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 7-(2-ethoxyethyl)-8-(3-methoxypropylimino)-3-methyl-5,9-dihydro-4H-purine-2,6-dione |
| SMILES | CCOCCN1/C(=N/CCCOC)NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C14H25N5O4/c1-4-23-9-7-19-10-11(18(2)14(21)17-12(10)20)16-13(19)15-6-5-8-22-3/h10-11H,4-9H2,1-3H3,(H,15,16)(H,17,20,21) |
| InChIKey | BKORXYUIBCLGAM-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|