C23H27N5O3 — CID 167997893
8-[(4-methoxyphenyl)methylimino]-3-methyl-7-(3-phenylpropyl)-5,9-dihydro-4H-purine-2,6-dione (PubChem CID 167997893) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is 8-[(4-methoxyphenyl)methylimino]-3-methyl-7-(3-phenylpropyl)-5,9-dihydro-4H-purine-2,6-dione.
| Compound Name | 8-[(4-methoxyphenyl)methylimino]-3-methyl-7-(3-phenylpropyl)-5,9-dihydro-4H-purine-2,6-dione |
|---|---|
| PubChem CID | 167997893 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 8-[(4-methoxyphenyl)methylimino]-3-methyl-7-(3-phenylpropyl)-5,9-dihydro-4H-purine-2,6-dione |
| SMILES | COc1ccc(C/N=C2\NC3C(C(=O)NC(=O)N3C)N2CCCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H27N5O3/c1-27-20-19(21(29)26-23(27)30)28(14-6-9-16-7-4-3-5-8-16)22(25-20)24-15-17-10-12-18(31-2)13-11-17/h3-5,7-8,10-13,19-20H,6,9,14-15H2,1-2H3,(H,24,25)(H,26,29,30) |
| InChIKey | DNSOZPGNUVMKFG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|