C21H22ClN5O2 — CID 156593011
8-[(2-chlorophenyl)methylimino]-3-methyl-7-[(2-methylphenyl)methyl]-5,9-dihydro-4H-purine-2,6-dione (PubChem CID 156593011) has the molecular formula C21H22ClN5O2 and a molecular weight of 411.89 g/mol. Its IUPAC name is 8-[(2-chlorophenyl)methylimino]-3-methyl-7-[(2-methylphenyl)methyl]-5,9-dihydro-4H-purine-2,6-dione.
| Compound Name | 8-[(2-chlorophenyl)methylimino]-3-methyl-7-[(2-methylphenyl)methyl]-5,9-dihydro-4H-purine-2,6-dione |
|---|---|
| PubChem CID | 156593011 |
| Molecular Formula | C21H22ClN5O2 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 8-[(2-chlorophenyl)methylimino]-3-methyl-7-[(2-methylphenyl)methyl]-5,9-dihydro-4H-purine-2,6-dione |
| SMILES | Cc1ccccc1CN1/C(=N/Cc2ccccc2Cl)NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C21H22ClN5O2/c1-13-7-3-4-9-15(13)12-27-17-18(26(2)21(29)25-19(17)28)24-20(27)23-11-14-8-5-6-10-16(14)22/h3-10,17-18H,11-12H2,1-2H3,(H,23,24)(H,25,28,29) |
| InChIKey | PBEICKMYBYNMGQ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|