C20H20ClN5O2 — CID 137264840
8-benzylimino-7-[(2-chlorophenyl)methyl]-3-methyl-5,9-dihydro-4H-purine-2,6-dione (PubChem CID 137264840) has the molecular formula C20H20ClN5O2 and a molecular weight of 397.87 g/mol. Its IUPAC name is 8-benzylimino-7-[(2-chlorophenyl)methyl]-3-methyl-5,9-dihydro-4H-purine-2,6-dione.
| Compound Name | 8-benzylimino-7-[(2-chlorophenyl)methyl]-3-methyl-5,9-dihydro-4H-purine-2,6-dione |
|---|---|
| PubChem CID | 137264840 |
| Molecular Formula | C20H20ClN5O2 |
| Molecular Weight | 397.87 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 8-benzylimino-7-[(2-chlorophenyl)methyl]-3-methyl-5,9-dihydro-4H-purine-2,6-dione |
| SMILES | CN1C(=O)NC(=O)C2C1N/C(=N\Cc1ccccc1)N2Cc1ccccc1Cl |
| InChI | InChI=1S/C20H20ClN5O2/c1-25-17-16(18(27)24-20(25)28)26(12-14-9-5-6-10-15(14)21)19(23-17)22-11-13-7-3-2-4-8-13/h2-10,16-17H,11-12H2,1H3,(H,22,23)(H,24,27,28) |
| InChIKey | VBEIRNVISUKSCZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.87 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|