C14H16N4O2S — CID 78203633
3-methyl-7-[(4-methylphenyl)methyl]-8-sulfanylidene-5,9-dihydro-4H-purine-2,6-dione (PubChem CID 78203633) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is 3-methyl-7-[(4-methylphenyl)methyl]-8-sulfanylidene-5,9-dihydro-4H-purine-2,6-dione.
| Compound Name | 3-methyl-7-[(4-methylphenyl)methyl]-8-sulfanylidene-5,9-dihydro-4H-purine-2,6-dione |
|---|---|
| PubChem CID | 78203633 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 3-methyl-7-[(4-methylphenyl)methyl]-8-sulfanylidene-5,9-dihydro-4H-purine-2,6-dione |
| SMILES | Cc1ccc(CN2C(=S)NC3C2C(=O)NC(=O)N3C)cc1 |
| InChI | InChI=1S/C14H16N4O2S/c1-8-3-5-9(6-4-8)7-18-10-11(15-14(18)21)17(2)13(20)16-12(10)19/h3-6,10-11H,7H2,1-2H3,(H,15,21)(H,16,19,20) |
| InChIKey | OZNMAERJNJKOLM-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|