C6H13N5 — CID 136590852
(2S)-2,5-dimethyl-6-methylimino-1,2-dihydro-1,3,5-triazin-4-amine (PubChem CID 136590852) has the molecular formula C6H13N5 and a molecular weight of 155.20 g/mol. Its IUPAC name is (2S)-2,5-dimethyl-6-methylimino-1,2-dihydro-1,3,5-triazin-4-amine.
| Compound Name | (2S)-2,5-dimethyl-6-methylimino-1,2-dihydro-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 136590852 |
| Molecular Formula | C6H13N5 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.12 |
| IUPAC Name | (2S)-2,5-dimethyl-6-methylimino-1,2-dihydro-1,3,5-triazin-4-amine |
| SMILES | C/N=C1\N[C@H](C)N=C(N)N1C |
| InChI | InChI=1S/C6H13N5/c1-4-9-5(7)11(3)6(8-2)10-4/h4H,1-3H3,(H2,7,9)(H,8,10)/t4-/m1/s1 |
| InChIKey | QSLSTULTYMRONL-SCSAIBSYSA-N |
| XLogP | -0.83 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|