C14H21N5 — CID 136590889
2,5-dimethyl-6-(3-phenylpropylimino)-1,2-dihydro-1,3,5-triazin-4-amine (PubChem CID 136590889) has the molecular formula C14H21N5 and a molecular weight of 259.36 g/mol. Its IUPAC name is 2,5-dimethyl-6-(3-phenylpropylimino)-1,2-dihydro-1,3,5-triazin-4-amine.
| Compound Name | 2,5-dimethyl-6-(3-phenylpropylimino)-1,2-dihydro-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 136590889 |
| Molecular Formula | C14H21N5 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 2,5-dimethyl-6-(3-phenylpropylimino)-1,2-dihydro-1,3,5-triazin-4-amine |
| SMILES | CC1N=C(N)N(C)/C(=N/CCCc2ccccc2)N1 |
| InChI | InChI=1S/C14H21N5/c1-11-17-13(15)19(2)14(18-11)16-10-6-9-12-7-4-3-5-8-12/h3-5,7-8,11H,6,9-10H2,1-2H3,(H2,15,17)(H,16,18) |
| InChIKey | ZJHOSLGCEWBPMW-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|