About 2,6-dimethyl-3,6-dihydro-2H-1,3,5-thiadiazin-4-amine
2,6-dimethyl-3,6-dihydro-2H-1,3,5-thiadiazin-4-amine (PubChem CID 12600795) has the molecular formula C5H11N3S
and a molecular weight of 145.23 g/mol. Its IUPAC name is 2,6-dimethyl-3,6-dihydro-2H-1,3,5-thiadiazin-4-amine.
Analyze 2,6-dimethyl-3,6-dihydro-2H-1,3,5-thiadiazin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-3,6-dihydro-2H-1,3,5-thiadiazin-4-amine?
The IUPAC name of 2,6-dimethyl-3,6-dihydro-2H-1,3,5-thiadiazin-4-amine (CID 12600795) is 2,6-dimethyl-3,6-dihydro-2H-1,3,5-thiadiazin-4-amine.
What is the SMILES notation for 2,6-dimethyl-3,6-dihydro-2H-1,3,5-thiadiazin-4-amine?
The canonical SMILES for 2,6-dimethyl-3,6-dihydro-2H-1,3,5-thiadiazin-4-amine is CC1N=C(N)NC(C)S1.
What is the InChIKey of 2,6-dimethyl-3,6-dihydro-2H-1,3,5-thiadiazin-4-amine?
The InChIKey is NTOJDSKIHGYCKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3S/c1-3-7-5(6)8-4(2)9-3/h3-4H,1-2H3,(H3,6,7,8).
What are the key properties of 2,6-dimethyl-3,6-dihydro-2H-1,3,5-thiadiazin-4-amine?
2,6-dimethyl-3,6-dihydro-2H-1,3,5-thiadiazin-4-amine has a molecular weight of 145.23 g/mol, XLogP of 0.33, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-3,6-dihydro-2H-1,3,5-thiadiazin-4-amine is sourced from PubChem (CID 12600795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).