C3H10N6 — CID 90706888
1,2,3,4-tetrahydro-1,3,5-triazine-2,4,6-triamine (PubChem CID 90706888) has the molecular formula C3H10N6 and a molecular weight of 130.16 g/mol. Its IUPAC name is 1,2,3,4-tetrahydro-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 1,2,3,4-tetrahydro-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 90706888 |
| Molecular Formula | C3H10N6 |
| Molecular Weight | 130.16 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | 1,2,3,4-tetrahydro-1,3,5-triazine-2,4,6-triamine |
| SMILES | NC1=NC(N)NC(N)N1 |
| InChI | InChI=1S/C3H10N6/c4-1-7-2(5)9-3(6)8-1/h1-2,7H,4-5H2,(H3,6,8,9) |
| InChIKey | NASWSVOEPBZNCE-UHFFFAOYSA-N |
| XLogP | -3.02 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.16 |
| LogP ≤ 5 | -3.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |