C5H9N3O — CID 67310454
(3aS,6aR)-4,5,6,6a-tetrahydro-3aH-pyrrolo[3,4-d][1,3]oxazol-2-amine (PubChem CID 67310454) has the molecular formula C5H9N3O and a molecular weight of 127.15 g/mol. Its IUPAC name is (3aS,6aR)-4,5,6,6a-tetrahydro-3aH-pyrrolo[3,4-d][1,3]oxazol-2-amine.
| Compound Name | (3aS,6aR)-4,5,6,6a-tetrahydro-3aH-pyrrolo[3,4-d][1,3]oxazol-2-amine |
|---|---|
| PubChem CID | 67310454 |
| Molecular Formula | C5H9N3O |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.07 |
| IUPAC Name | (3aS,6aR)-4,5,6,6a-tetrahydro-3aH-pyrrolo[3,4-d][1,3]oxazol-2-amine |
| SMILES | NC1=N[C@H]2CNC[C@H]2O1 |
| InChI | InChI=1S/C5H9N3O/c6-5-8-3-1-7-2-4(3)9-5/h3-4,7H,1-2H2,(H2,6,8)/t3-,4+/m0/s1 |
| InChIKey | SVQOGXARIDFIEJ-IUYQGCFVSA-N |
| XLogP | -1.33 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |