C8H10N6O2 — CID 102264493
4-amino-5-oxa-1,3,8,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,9,11-triene-10-carboxamide (PubChem CID 102264493) has the molecular formula C8H10N6O2 and a molecular weight of 222.21 g/mol. Its IUPAC name is 4-amino-5-oxa-1,3,8,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,9,11-triene-10-carboxamide.
| Compound Name | 4-amino-5-oxa-1,3,8,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,9,11-triene-10-carboxamide |
|---|---|
| PubChem CID | 102264493 |
| Molecular Formula | C8H10N6O2 |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 4-amino-5-oxa-1,3,8,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,9,11-triene-10-carboxamide |
| SMILES | NC(=O)c1ncn2c1NCC1OC(N)=NC12 |
| InChI | InChI=1S/C8H10N6O2/c9-5(15)4-7-11-1-3-6(13-8(10)16-3)14(7)2-12-4/h2-3,6,11H,1H2,(H2,9,15)(H2,10,13) |
| InChIKey | RETMKMRTSFZVTL-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 120.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |