C10H12N6O3 — CID 139114983
(2R,6R,7S)-4-amino-7-[(1R)-1,2-dihydroxyethyl]-5-oxa-1,3,8,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,9,11-triene-10-carbonitrile (PubChem CID 139114983) has the molecular formula C10H12N6O3 and a molecular weight of 264.25 g/mol. Its IUPAC name is (2R,6R,7S)-4-amino-7-[(1R)-1,2-dihydroxyethyl]-5-oxa-1,3,8,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,9,11-triene-10-carbonitrile.
| Compound Name | (2R,6R,7S)-4-amino-7-[(1R)-1,2-dihydroxyethyl]-5-oxa-1,3,8,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,9,11-triene-10-carbonitrile |
|---|---|
| PubChem CID | 139114983 |
| Molecular Formula | C10H12N6O3 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (2R,6R,7S)-4-amino-7-[(1R)-1,2-dihydroxyethyl]-5-oxa-1,3,8,11-tetrazatricyclo[7.3.0.02,6]dodeca-3,9,11-triene-10-carbonitrile |
| SMILES | N#Cc1ncn2c1N[C@@H]([C@@H](O)CO)[C@H]1OC(N)=N[C@H]12 |
| InChI | InChI=1S/C10H12N6O3/c11-1-4-8-14-6(5(18)2-17)7-9(15-10(12)19-7)16(8)3-13-4/h3,5-7,9,14,17-18H,2H2,(H2,12,15)/t5-,6-,7+,9-/m0/s1 |
| InChIKey | CSICBFUULLSHNE-LKHWLPBLSA-N |
| XLogP | -1.89 |
| TPSA | 141.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |