C11H20N2O — CID 140510356
5-(2-methylpropyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-amine (PubChem CID 140510356) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 5-(2-methylpropyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-amine.
| Compound Name | 5-(2-methylpropyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 140510356 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 5-(2-methylpropyl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-amine |
| SMILES | CC(C)CC1CCC2OC(N)=NC2C1 |
| InChI | InChI=1S/C11H20N2O/c1-7(2)5-8-3-4-10-9(6-8)13-11(12)14-10/h7-10H,3-6H2,1-2H3,(H2,12,13) |
| InChIKey | LCLIXKTVSFAQBN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |