C11H20N2O — CID 115066365
(2-propan-2-yl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-6-yl)methanamine (PubChem CID 115066365) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is (2-propan-2-yl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-6-yl)methanamine.
| Compound Name | (2-propan-2-yl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-6-yl)methanamine |
|---|---|
| PubChem CID | 115066365 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | (2-propan-2-yl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-6-yl)methanamine |
| SMILES | CC(C)C1=NC2CCC(CN)CC2O1 |
| InChI | InChI=1S/C11H20N2O/c1-7(2)11-13-9-4-3-8(6-12)5-10(9)14-11/h7-10H,3-6,12H2,1-2H3 |
| InChIKey | NNPSQQISYUOTPV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |