C14H25N3 — CID 163575119
6-ethyl-6-methyl-1,3a,4,5,6a,7,8,9,9a,9b-decahydroperimidin-2-amine (PubChem CID 163575119) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is 6-ethyl-6-methyl-1,3a,4,5,6a,7,8,9,9a,9b-decahydroperimidin-2-amine.
| Compound Name | 6-ethyl-6-methyl-1,3a,4,5,6a,7,8,9,9a,9b-decahydroperimidin-2-amine |
|---|---|
| PubChem CID | 163575119 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | 6-ethyl-6-methyl-1,3a,4,5,6a,7,8,9,9a,9b-decahydroperimidin-2-amine |
| SMILES | CCC1(C)CCC2N=C(N)NC3CCCC1C23 |
| InChI | InChI=1S/C14H25N3/c1-3-14(2)8-7-11-12-9(14)5-4-6-10(12)16-13(15)17-11/h9-12H,3-8H2,1-2H3,(H3,15,16,17) |
| InChIKey | GCUDPYKDDKEOIQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |