C11H20O — CID 81421329
7,7-diethylbicyclo[3.2.0]heptan-6-ol (PubChem CID 81421329) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is 7,7-diethylbicyclo[3.2.0]heptan-6-ol.
| Compound Name | 7,7-diethylbicyclo[3.2.0]heptan-6-ol |
|---|---|
| PubChem CID | 81421329 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 7,7-diethylbicyclo[3.2.0]heptan-6-ol |
| SMILES | CCC1(CC)C(O)C2CCCC21 |
| InChI | InChI=1S/C11H20O/c1-3-11(4-2)9-7-5-6-8(9)10(11)12/h8-10,12H,3-7H2,1-2H3 |
| InChIKey | HAPGJCOTGDQXNA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |