C15H23NO2 — CID 15548455
N,N-diethyl-10-oxotricyclo[5.3.0.02,6]decane-1-carboxamide (PubChem CID 15548455) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is N,N-diethyl-10-oxotricyclo[5.3.0.02,6]decane-1-carboxamide.
| Compound Name | N,N-diethyl-10-oxotricyclo[5.3.0.02,6]decane-1-carboxamide |
|---|---|
| PubChem CID | 15548455 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | N,N-diethyl-10-oxotricyclo[5.3.0.02,6]decane-1-carboxamide |
| SMILES | CCN(CC)C(=O)C12C(=O)CCC1C1CCCC12 |
| InChI | InChI=1S/C15H23NO2/c1-3-16(4-2)14(18)15-11-7-5-6-10(11)12(15)8-9-13(15)17/h10-12H,3-9H2,1-2H3 |
| InChIKey | VBTADIVDUUUYCU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|