C17H27NO2 — CID 11369449
(1S,4aR,8aS)-N,N-diethyl-4a-methyl-6-methylidene-2-oxo-3,4,5,7,8,8a-hexahydro-1H-naphthalene-1-carboxamide (PubChem CID 11369449) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is (1S,4aR,8aS)-N,N-diethyl-4a-methyl-6-methylidene-2-oxo-3,4,5,7,8,8a-hexahydro-1H-naphthalene-1-carboxamide.
| Compound Name | (1S,4aR,8aS)-N,N-diethyl-4a-methyl-6-methylidene-2-oxo-3,4,5,7,8,8a-hexahydro-1H-naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 11369449 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | (1S,4aR,8aS)-N,N-diethyl-4a-methyl-6-methylidene-2-oxo-3,4,5,7,8,8a-hexahydro-1H-naphthalene-1-carboxamide |
| SMILES | C=C1CC[C@H]2[C@H](C(=O)N(CC)CC)C(=O)CC[C@]2(C)C1 |
| InChI | InChI=1S/C17H27NO2/c1-5-18(6-2)16(20)15-13-8-7-12(3)11-17(13,4)10-9-14(15)19/h13,15H,3,5-11H2,1-2,4H3/t13-,15-,17+/m0/s1 |
| InChIKey | FJYGACAVTSBGRC-JLJPHGGASA-N |
| XLogP | 3.20 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|