C19H35N3 — CID 73237825
10-ethyl-9-heptan-2-yl-5,7-diazatricyclo[6.3.1.04,12]dodec-6-en-6-amine (PubChem CID 73237825) has the molecular formula C19H35N3 and a molecular weight of 305.51 g/mol. Its IUPAC name is 10-ethyl-9-heptan-2-yl-5,7-diazatricyclo[6.3.1.04,12]dodec-6-en-6-amine.
| Compound Name | 10-ethyl-9-heptan-2-yl-5,7-diazatricyclo[6.3.1.04,12]dodec-6-en-6-amine |
|---|---|
| PubChem CID | 73237825 |
| Molecular Formula | C19H35N3 |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.28 |
| IUPAC Name | 10-ethyl-9-heptan-2-yl-5,7-diazatricyclo[6.3.1.04,12]dodec-6-en-6-amine |
| SMILES | CCCCCC(C)C1C(CC)CC2CCC3NC(N)=NC1C23 |
| InChI | InChI=1S/C19H35N3/c1-4-6-7-8-12(3)16-13(5-2)11-14-9-10-15-17(14)18(16)22-19(20)21-15/h12-18H,4-11H2,1-3H3,(H3,20,21,22) |
| InChIKey | PQDSEBCMPXDKMF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|