C8H17N3 — CID 79510805
5-pentan-2-yl-4,5-dihydro-1H-imidazol-2-amine (PubChem CID 79510805) has the molecular formula C8H17N3 and a molecular weight of 155.24 g/mol. Its IUPAC name is 5-pentan-2-yl-4,5-dihydro-1H-imidazol-2-amine.
| Compound Name | 5-pentan-2-yl-4,5-dihydro-1H-imidazol-2-amine |
|---|---|
| PubChem CID | 79510805 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | 5-pentan-2-yl-4,5-dihydro-1H-imidazol-2-amine |
| SMILES | CCCC(C)C1CN=C(N)N1 |
| InChI | InChI=1S/C8H17N3/c1-3-4-6(2)7-5-10-8(9)11-7/h6-7H,3-5H2,1-2H3,(H3,9,10,11) |
| InChIKey | GVYJUHQCYNYLHH-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |