C6H11N3S — CID 155441884
(3aR,7aR)-3,3a,4,6,7,7a-hexahydrothiopyrano[3,4-d]imidazol-2-amine (PubChem CID 155441884) has the molecular formula C6H11N3S and a molecular weight of 157.24 g/mol. Its IUPAC name is (3aR,7aR)-3,3a,4,6,7,7a-hexahydrothiopyrano[3,4-d]imidazol-2-amine.
| Compound Name | (3aR,7aR)-3,3a,4,6,7,7a-hexahydrothiopyrano[3,4-d]imidazol-2-amine |
|---|---|
| PubChem CID | 155441884 |
| Molecular Formula | C6H11N3S |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | (3aR,7aR)-3,3a,4,6,7,7a-hexahydrothiopyrano[3,4-d]imidazol-2-amine |
| SMILES | NC1=N[C@@H]2CCSC[C@@H]2N1 |
| InChI | InChI=1S/C6H11N3S/c7-6-8-4-1-2-10-3-5(4)9-6/h4-5H,1-3H2,(H3,7,8,9)/t4-,5+/m1/s1 |
| InChIKey | RJUXMRZHZVBQOB-UHNVWZDZSA-N |
| XLogP | -0.22 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |